C16H16N4O — CID 22149343
N-[amino(3,4-dihydro-2H-quinolin-1-yl)methylidene]pyridine-3-carboxamide (PubChem CID 22149343) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[amino(3,4-dihydro-2H-quinolin-1-yl)methylidene]pyridine-3-carboxamide.
| Compound Name | N-[amino(3,4-dihydro-2H-quinolin-1-yl)methylidene]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22149343 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-[amino(3,4-dihydro-2H-quinolin-1-yl)methylidene]pyridine-3-carboxamide |
| SMILES | N/C(=N\C(=O)c1cccnc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H16N4O/c17-16(19-15(21)13-6-3-9-18-11-13)20-10-4-7-12-5-1-2-8-14(12)20/h1-3,5-6,8-9,11H,4,7,10H2,(H2,17,19,21) |
| InChIKey | TWFFNXGYWAQZAI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|