C14H13N3OS — CID 22149279
N-[amino(2,3-dihydroindol-1-yl)methylidene]thiophene-2-carboxamide (PubChem CID 22149279) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is N-[amino(2,3-dihydroindol-1-yl)methylidene]thiophene-2-carboxamide.
| Compound Name | N-[amino(2,3-dihydroindol-1-yl)methylidene]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22149279 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[amino(2,3-dihydroindol-1-yl)methylidene]thiophene-2-carboxamide |
| SMILES | N/C(=N\C(=O)c1cccs1)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H13N3OS/c15-14(16-13(18)12-6-3-9-19-12)17-8-7-10-4-1-2-5-11(10)17/h1-6,9H,7-8H2,(H2,15,16,18) |
| InChIKey | RTNRATJQAOSXGO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|