C13H12N2OS — CID 61090033
(3-aminothiophen-2-yl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 61090033) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is (3-aminothiophen-2-yl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3-aminothiophen-2-yl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 61090033 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (3-aminothiophen-2-yl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | Nc1ccsc1C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C13H12N2OS/c14-10-6-8-17-12(10)13(16)15-7-5-9-3-1-2-4-11(9)15/h1-4,6,8H,5,7,14H2 |
| InChIKey | ZUSJVBACTIEHEO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |