C15H13FN2O — CID 55099809
(2-amino-3-fluorophenyl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 55099809) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is (2-amino-3-fluorophenyl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2-amino-3-fluorophenyl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 55099809 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (2-amino-3-fluorophenyl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | Nc1c(F)cccc1C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H13FN2O/c16-12-6-3-5-11(14(12)17)15(19)18-9-8-10-4-1-2-7-13(10)18/h1-7H,8-9,17H2 |
| InChIKey | BBQAELFGZISLBC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|