C15H11F2NO — CID 4815727
(3,5-difluorophenyl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 4815727) has the molecular formula C15H11F2NO and a molecular weight of 259.25 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3,5-difluorophenyl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 4815727 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (3,5-difluorophenyl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H11F2NO/c16-12-7-11(8-13(17)9-12)15(19)18-6-5-10-3-1-2-4-14(10)18/h1-4,7-9H,5-6H2 |
| InChIKey | QBKLWZIOKOKSKI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |