C16H12FNO2 — CID 82123544
1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenyl)ethane-1,2-dione (PubChem CID 82123544) has the molecular formula C16H12FNO2 and a molecular weight of 269.28 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenyl)ethane-1,2-dione.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 82123544 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12FNO2/c17-13-7-5-12(6-8-13)15(19)16(20)18-10-9-11-3-1-2-4-14(11)18/h1-8H,9-10H2 |
| InChIKey | YPRBKESLKSVSQD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|