C19H15FN2O2 — CID 113208636
1-(3,4-dihydro-2H-quinolin-1-yl)-2-(6-fluoro-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 113208636) has the molecular formula C19H15FN2O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(6-fluoro-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(6-fluoro-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 113208636 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(6-fluoro-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCc2ccccc21)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C19H15FN2O2/c20-13-7-8-14-15(11-21-16(14)10-13)18(23)19(24)22-9-3-5-12-4-1-2-6-17(12)22/h1-2,4,6-8,10-11,21H,3,5,9H2 |
| InChIKey | JYPHRYNEFKTZQW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|