C17H14F2N2O2 — CID 108505775
N-(2,4-difluorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoacetamide (PubChem CID 108505775) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108505775 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H14F2N2O2/c18-12-7-8-14(13(19)10-12)20-16(22)17(23)21-9-3-5-11-4-1-2-6-15(11)21/h1-2,4,6-8,10H,3,5,9H2,(H,20,22) |
| InChIKey | NSCFAEVIVPUQHN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|