C17H12ClF3N2O2 — CID 108531995
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide (PubChem CID 108531995) has the molecular formula C17H12ClF3N2O2 and a molecular weight of 368.74 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108531995 |
| Molecular Formula | C17H12ClF3N2O2 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H12ClF3N2O2/c18-11-5-6-13(12(9-11)17(19,20)21)22-15(24)16(25)23-8-7-10-3-1-2-4-14(10)23/h1-6,9H,7-8H2,(H,22,24) |
| InChIKey | GBRVVIWFCWVEQM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|