C15H14N2O2 — CID 53011678
1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1H-pyrrol-2-yl)ethane-1,2-dione (PubChem CID 53011678) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1H-pyrrol-2-yl)ethane-1,2-dione.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1H-pyrrol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 53011678 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(1H-pyrrol-2-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCc2ccccc21)c1ccc[nH]1 |
| InChI | InChI=1S/C15H14N2O2/c18-14(12-7-3-9-16-12)15(19)17-10-4-6-11-5-1-2-8-13(11)17/h1-3,5,7-9,16H,4,6,10H2 |
| InChIKey | JXWJNRCMEOXUHC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|