C17H17NO3 — CID 687165
2,3-dihydroindol-1-yl-(3,5-dimethoxyphenyl)methanone (PubChem CID 687165) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(3,5-dimethoxyphenyl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 687165 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H17NO3/c1-20-14-9-13(10-15(11-14)21-2)17(19)18-8-7-12-5-3-4-6-16(12)18/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | ACTOMWYLRMAFMW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |