C17H17NO2 — CID 755245
3,4-dihydro-2H-quinolin-1-yl-(3-methoxyphenyl)methanone (PubChem CID 755245) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-(3-methoxyphenyl)methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 755245 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C17H17NO2/c1-20-15-9-4-7-14(12-15)17(19)18-11-5-8-13-6-2-3-10-16(13)18/h2-4,6-7,9-10,12H,5,8,11H2,1H3 |
| InChIKey | QWAFFOCOBWNZAI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |