C15H12BrFN2O — CID 114455629
(7-amino-2,3-dihydroindol-1-yl)-(2-bromo-3-fluorophenyl)methanone (PubChem CID 114455629) has the molecular formula C15H12BrFN2O and a molecular weight of 335.18 g/mol. Its IUPAC name is (7-amino-2,3-dihydroindol-1-yl)-(2-bromo-3-fluorophenyl)methanone.
| Compound Name | (7-amino-2,3-dihydroindol-1-yl)-(2-bromo-3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 114455629 |
| Molecular Formula | C15H12BrFN2O |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (7-amino-2,3-dihydroindol-1-yl)-(2-bromo-3-fluorophenyl)methanone |
| SMILES | Nc1cccc2c1N(C(=O)c1cccc(F)c1Br)CC2 |
| InChI | InChI=1S/C15H12BrFN2O/c16-13-10(4-2-5-11(13)17)15(20)19-8-7-9-3-1-6-12(18)14(9)19/h1-6H,7-8,18H2 |
| InChIKey | MWNSHXZHONYKQT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|