C21H17FN2O2 — CID 155969335
(7-amino-2,3-dihydroindol-1-yl)-[4-(4-fluorophenoxy)phenyl]methanone (PubChem CID 155969335) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is (7-amino-2,3-dihydroindol-1-yl)-[4-(4-fluorophenoxy)phenyl]methanone.
| Compound Name | (7-amino-2,3-dihydroindol-1-yl)-[4-(4-fluorophenoxy)phenyl]methanone |
|---|---|
| PubChem CID | 155969335 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (7-amino-2,3-dihydroindol-1-yl)-[4-(4-fluorophenoxy)phenyl]methanone |
| SMILES | Nc1cccc2c1N(C(=O)c1ccc(Oc3ccc(F)cc3)cc1)CC2 |
| InChI | InChI=1S/C21H17FN2O2/c22-16-6-10-18(11-7-16)26-17-8-4-15(5-9-17)21(25)24-13-12-14-2-1-3-19(23)20(14)24/h1-11H,12-13,23H2 |
| InChIKey | SQMWRLAWRUOLRW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|