C14H13N3O3 — CID 114455746
4-(7-amino-2,3-dihydroindole-1-carbonyl)-6-hydroxy-1H-pyridin-2-one (PubChem CID 114455746) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-(7-amino-2,3-dihydroindole-1-carbonyl)-6-hydroxy-1H-pyridin-2-one.
| Compound Name | 4-(7-amino-2,3-dihydroindole-1-carbonyl)-6-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 114455746 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(7-amino-2,3-dihydroindole-1-carbonyl)-6-hydroxy-1H-pyridin-2-one |
| SMILES | Nc1cccc2c1N(C(=O)c1cc(O)[nH]c(=O)c1)CC2 |
| InChI | InChI=1S/C14H13N3O3/c15-10-3-1-2-8-4-5-17(13(8)10)14(20)9-6-11(18)16-12(19)7-9/h1-3,6-7H,4-5,15H2,(H2,16,18,19) |
| InChIKey | JMNCOXJNICZEEK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|