C16H16N2OS — CID 114455584
(7-amino-2,3-dihydroindol-1-yl)-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone (PubChem CID 114455584) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is (7-amino-2,3-dihydroindol-1-yl)-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone.
| Compound Name | (7-amino-2,3-dihydroindol-1-yl)-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 114455584 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (7-amino-2,3-dihydroindol-1-yl)-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone |
| SMILES | Nc1cccc2c1N(C(=O)c1cc3c(s1)CCC3)CC2 |
| InChI | InChI=1S/C16H16N2OS/c17-12-5-1-3-10-7-8-18(15(10)12)16(19)14-9-11-4-2-6-13(11)20-14/h1,3,5,9H,2,4,6-8,17H2 |
| InChIKey | IZBKVNANAQHIBW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|