C14H14N2O2 — CID 82084861
(8-amino-3,4-dihydro-2H-quinolin-1-yl)-(furan-2-yl)methanone (PubChem CID 82084861) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (8-amino-3,4-dihydro-2H-quinolin-1-yl)-(furan-2-yl)methanone.
| Compound Name | (8-amino-3,4-dihydro-2H-quinolin-1-yl)-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 82084861 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (8-amino-3,4-dihydro-2H-quinolin-1-yl)-(furan-2-yl)methanone |
| SMILES | Nc1cccc2c1N(C(=O)c1ccco1)CCC2 |
| InChI | InChI=1S/C14H14N2O2/c15-11-6-1-4-10-5-2-8-16(13(10)11)14(17)12-7-3-9-18-12/h1,3-4,6-7,9H,2,5,8,15H2 |
| InChIKey | WRSNCMPQLHLLLO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|