C13H12N2O3 — CID 82294082
(8-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-(furan-2-yl)methanone (PubChem CID 82294082) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is (8-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-(furan-2-yl)methanone.
| Compound Name | (8-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 82294082 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (8-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-(furan-2-yl)methanone |
| SMILES | Nc1cccc2c1OCCN2C(=O)c1ccco1 |
| InChI | InChI=1S/C13H12N2O3/c14-9-3-1-4-10-12(9)18-8-6-15(10)13(16)11-5-2-7-17-11/h1-5,7H,6,8,14H2 |
| InChIKey | LUVAOBOTCXFKNK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|