C14H14N2O2 — CID 53013851
furan-2-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone (PubChem CID 53013851) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is furan-2-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone.
| Compound Name | furan-2-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone |
|---|---|
| PubChem CID | 53013851 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | furan-2-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C14H14N2O2/c1-15-8-9-16(12-6-3-2-5-11(12)15)14(17)13-7-4-10-18-13/h2-7,10H,8-9H2,1H3 |
| InChIKey | AXGRYNPCCKEZEY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |