C17H16ClNO4 — CID 132604646
[(5R)-1-(furan-2-carbonyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-chloroacetate (PubChem CID 132604646) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is [(5R)-1-(furan-2-carbonyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-chloroacetate.
| Compound Name | [(5R)-1-(furan-2-carbonyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 132604646 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [(5R)-1-(furan-2-carbonyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-chloroacetate |
| SMILES | O=C(CCl)O[C@@H]1CCCN(C(=O)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C17H16ClNO4/c18-11-16(20)23-14-7-3-9-19(13-6-2-1-5-12(13)14)17(21)15-8-4-10-22-15/h1-2,4-6,8,10,14H,3,7,9,11H2/t14-/m1/s1 |
| InChIKey | XHFBBVMIZACNJA-CQSZACIVSA-N |
| XLogP | 3.54 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|