C12H10N2OS — CID 110856972
2,3-dihydroindol-1-yl(1,3-thiazol-5-yl)methanone (PubChem CID 110856972) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl(1,3-thiazol-5-yl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 110856972 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2,3-dihydroindol-1-yl(1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1cncs1)N1CCc2ccccc21 |
| InChI | InChI=1S/C12H10N2OS/c15-12(11-7-13-8-16-11)14-6-5-9-3-1-2-4-10(9)14/h1-4,7-8H,5-6H2 |
| InChIKey | RKBVXCGGYXHJIC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |