C14H14N4O — CID 104642375
2,3-dihydroindol-1-yl-(5-hydrazinyl-2-pyridinyl)methanone (PubChem CID 104642375) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(5-hydrazinyl-2-pyridinyl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(5-hydrazinyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 104642375 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(5-hydrazinyl-2-pyridinyl)methanone |
| SMILES | NNc1ccc(C(=O)N2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C14H14N4O/c15-17-11-5-6-12(16-9-11)14(19)18-8-7-10-3-1-2-4-13(10)18/h1-6,9,17H,7-8,15H2 |
| InChIKey | GJEQBTDXPKPJRV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|