C22H21N3O — CID 109197739
2,3-dihydroindol-1-yl-[5-(2,3-dimethylanilino)-2-pyridinyl]methanone (PubChem CID 109197739) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[5-(2,3-dimethylanilino)-2-pyridinyl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[5-(2,3-dimethylanilino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109197739 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[5-(2,3-dimethylanilino)-2-pyridinyl]methanone |
| SMILES | Cc1cccc(Nc2ccc(C(=O)N3CCc4ccccc43)nc2)c1C |
| InChI | InChI=1S/C22H21N3O/c1-15-6-5-8-19(16(15)2)24-18-10-11-20(23-14-18)22(26)25-13-12-17-7-3-4-9-21(17)25/h3-11,14,24H,12-13H2,1-2H3 |
| InChIKey | QSZJPPIEDAEIAU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |