C12H11N3O2 — CID 110857028
(2-amino-1,3-oxazol-4-yl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 110857028) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is (2-amino-1,3-oxazol-4-yl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2-amino-1,3-oxazol-4-yl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110857028 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (2-amino-1,3-oxazol-4-yl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | Nc1nc(C(=O)N2CCc3ccccc32)co1 |
| InChI | InChI=1S/C12H11N3O2/c13-12-14-9(7-17-12)11(16)15-6-5-8-3-1-2-4-10(8)15/h1-4,7H,5-6H2,(H2,13,14) |
| InChIKey | CHJFLTYEGITVNK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |