C18H15N3O2 — CID 3856051
[2-(3-aminophenyl)-1,3-oxazol-4-yl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 3856051) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is [2-(3-aminophenyl)-1,3-oxazol-4-yl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [2-(3-aminophenyl)-1,3-oxazol-4-yl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 3856051 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [2-(3-aminophenyl)-1,3-oxazol-4-yl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | Nc1cccc(-c2nc(C(=O)N3CCc4ccccc43)co2)c1 |
| InChI | InChI=1S/C18H15N3O2/c19-14-6-3-5-13(10-14)17-20-15(11-23-17)18(22)21-9-8-12-4-1-2-7-16(12)21/h1-7,10-11H,8-9,19H2 |
| InChIKey | CNCNKBMLHROAKB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|