About (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone
(5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone (PubChem CID 99697107) has the molecular formula C18H13BrN2O2
and a molecular weight of 369.22 g/mol. Its IUPAC name is (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone |
| PubChem CID | 99697107 |
| Molecular Formula | C18H13BrN2O2 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone |
| SMILES | O=C(c1coc(-c2ccccc2)n1)N1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C18H13BrN2O2/c19-14-6-7-16-13(10-14)8-9-21(16)18(22)15-11-23-17(20-15)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2 |
| InChIKey | UQFHGCCEHVYBQX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone?
The IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone (CID 99697107) is (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone.
What is the SMILES notation for (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone?
The canonical SMILES for (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone is O=C(c1coc(-c2ccccc2)n1)N1CCc2cc(Br)ccc21.
What is the InChIKey of (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone?
The InChIKey is UQFHGCCEHVYBQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrN2O2/c19-14-6-7-16-13(10-14)8-9-21(16)18(22)15-11-23-17(20-15)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2.
What are the key properties of (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone?
(5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone has a molecular weight of 369.22 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2,3-dihydroindol-1-yl)-(2-phenyl-1,3-oxazol-4-yl)methanone is sourced from PubChem (CID 99697107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).