C10H5Br2NO3 — CID 107940915
2-(2,4-dibromophenyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 107940915) has the molecular formula C10H5Br2NO3 and a molecular weight of 346.96 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(2,4-dibromophenyl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107940915 |
| Molecular Formula | C10H5Br2NO3 |
| Molecular Weight | 346.96 g/mol |
| Exact Mass | 344.86 |
| IUPAC Name | 2-(2,4-dibromophenyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(-c2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C10H5Br2NO3/c11-5-1-2-6(7(12)3-5)9-13-8(4-16-9)10(14)15/h1-4H,(H,14,15) |
| InChIKey | WRORUCGNUKTBDN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.96 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |