C13H8Br2O2 — CID 175057498
2-(2,4-dibromophenyl)benzoic acid (PubChem CID 175057498) has the molecular formula C13H8Br2O2 and a molecular weight of 356.01 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)benzoic acid.
| Compound Name | 2-(2,4-dibromophenyl)benzoic acid |
|---|---|
| PubChem CID | 175057498 |
| Molecular Formula | C13H8Br2O2 |
| Molecular Weight | 356.01 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 2-(2,4-dibromophenyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H8Br2O2/c14-8-5-6-10(12(15)7-8)9-3-1-2-4-11(9)13(16)17/h1-7H,(H,16,17) |
| InChIKey | JUZDYDIIBLQUSO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |