C15H13BrO2 — CID 114032340
5-bromo-2-(2,3-dimethylphenyl)benzoic acid (PubChem CID 114032340) has the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. Its IUPAC name is 5-bromo-2-(2,3-dimethylphenyl)benzoic acid.
| Compound Name | 5-bromo-2-(2,3-dimethylphenyl)benzoic acid |
|---|---|
| PubChem CID | 114032340 |
| Molecular Formula | C15H13BrO2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 5-bromo-2-(2,3-dimethylphenyl)benzoic acid |
| SMILES | Cc1cccc(-c2ccc(Br)cc2C(=O)O)c1C |
| InChI | InChI=1S/C15H13BrO2/c1-9-4-3-5-12(10(9)2)13-7-6-11(16)8-14(13)15(17)18/h3-8H,1-2H3,(H,17,18) |
| InChIKey | LCQFWLOILOLLBI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |