About 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride
2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride (PubChem CID 67933497) has the molecular formula C14H11Cl3O4
and a molecular weight of 349.60 g/mol. Its IUPAC name is 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride |
| PubChem CID | 67933497 |
| Molecular Formula | C14H11Cl3O4 |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)c1ccccc1-c1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C14H9ClO4.2ClH/c15-8-5-6-10(12(7-8)14(18)19)9-3-1-2-4-11(9)13(16)17;;/h1-7H,(H,16,17)(H,18,19);2*1H |
| InChIKey | VDSNJERXLWAMFH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride?
The IUPAC name of 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride (CID 67933497) is 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride.
What is the SMILES notation for 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride?
The canonical SMILES for 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride is Cl.Cl.O=C(O)c1ccccc1-c1ccc(Cl)cc1C(=O)O.
What is the InChIKey of 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride?
The InChIKey is VDSNJERXLWAMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClO4.2ClH/c15-8-5-6-10(12(7-8)14(18)19)9-3-1-2-4-11(9)13(16)17;;/h1-7H,(H,16,17)(H,18,19);2*1H.
What are the key properties of 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride?
2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride has a molecular weight of 349.60 g/mol, XLogP of 4.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-carboxyphenyl)-5-chlorobenzoic acid;dihydrochloride is sourced from PubChem (CID 67933497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).