C12H9Br2NO4 — CID 114018633
2-(2,4-dibromophenyl)-5-ethoxy-1,3-oxazole-4-carboxylic acid (PubChem CID 114018633) has the molecular formula C12H9Br2NO4 and a molecular weight of 391.02 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-5-ethoxy-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(2,4-dibromophenyl)-5-ethoxy-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114018633 |
| Molecular Formula | C12H9Br2NO4 |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 388.89 |
| IUPAC Name | 2-(2,4-dibromophenyl)-5-ethoxy-1,3-oxazole-4-carboxylic acid |
| SMILES | CCOc1oc(-c2ccc(Br)cc2Br)nc1C(=O)O |
| InChI | InChI=1S/C12H9Br2NO4/c1-2-18-12-9(11(16)17)15-10(19-12)7-4-3-6(13)5-8(7)14/h3-5H,2H2,1H3,(H,16,17) |
| InChIKey | MRCXKILLGRMJEZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |