C13H10ClNO2 — CID 106685283
(2-chlorofuran-3-yl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 106685283) has the molecular formula C13H10ClNO2 and a molecular weight of 247.68 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2-chlorofuran-3-yl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 106685283 |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | (2-chlorofuran-3-yl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccoc1Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C13H10ClNO2/c14-12-10(6-8-17-12)13(16)15-7-5-9-3-1-2-4-11(9)15/h1-4,6,8H,5,7H2 |
| InChIKey | WFTHNODCEFNYEA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |