C18H14N2OS — CID 110372145
2,3-dihydroindol-1-yl-[3-(1,3-thiazol-2-yl)phenyl]methanone (PubChem CID 110372145) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[3-(1,3-thiazol-2-yl)phenyl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[3-(1,3-thiazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 110372145 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[3-(1,3-thiazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-c2nccs2)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H14N2OS/c21-18(20-10-8-13-4-1-2-7-16(13)20)15-6-3-5-14(12-15)17-19-9-11-22-17/h1-7,9,11-12H,8,10H2 |
| InChIKey | KFHHKALQEBDIKL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |