C14H14N2OS — CID 110388352
1-(2,3-dihydroindol-1-yl)-3-(1,3-thiazol-2-yl)propan-1-one (PubChem CID 110388352) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-(1,3-thiazol-2-yl)propan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-(1,3-thiazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 110388352 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-(1,3-thiazol-2-yl)propan-1-one |
| SMILES | O=C(CCc1nccs1)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H14N2OS/c17-14(6-5-13-15-8-10-18-13)16-9-7-11-3-1-2-4-12(11)16/h1-4,8,10H,5-7,9H2 |
| InChIKey | CANMAHQHWYZDRK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |