C20H26N6OS — CID 111811028
N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111811028) has the molecular formula C20H26N6OS and a molecular weight of 398.54 g/mol. Its IUPAC name is N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111811028 |
| Molecular Formula | C20H26N6OS |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCCC(=O)N1CCc2ccccc21)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C20H26N6OS/c21-19(24-11-13-25(14-12-24)20-23-9-15-28-20)22-8-3-6-18(27)26-10-7-16-4-1-2-5-17(16)26/h1-2,4-5,9,15H,3,6-8,10-14H2,(H2,21,22) |
| InChIKey | HELVWVPMGAHGAO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|