C17H24N4OS — CID 111810992
N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]thiomorpholine-4-carboximidamide (PubChem CID 111810992) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111810992 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N'-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\CCCC(=O)N1CCc2ccccc21)N1CCSCC1 |
| InChI | InChI=1S/C17H24N4OS/c18-17(20-10-12-23-13-11-20)19-8-3-6-16(22)21-9-7-14-4-1-2-5-15(14)21/h1-2,4-5H,3,6-13H2,(H2,18,19) |
| InChIKey | QLRIYFZFTDBTFQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|