C19H29IN4O — CID 86778447
N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 86778447) has the molecular formula C19H29IN4O and a molecular weight of 456.37 g/mol. Its IUPAC name is N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 86778447 |
| Molecular Formula | C19H29IN4O |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCC(=O)N1CCc2ccccc2C1)N1CCCCC1 |
| InChI | InChI=1S/C19H28N4O.HI/c20-19(22-12-4-1-5-13-22)21-11-6-9-18(24)23-14-10-16-7-2-3-8-17(16)15-23;/h2-3,7-8H,1,4-6,9-15H2,(H2,20,21);1H |
| InChIKey | JZJTZLUIHUGDCL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|