C19H28N4O — CID 111810724
N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111810724) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111810724 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CCCC(=O)N2Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C19H28N4O/c1-15-6-5-11-22(12-15)19(20)21-10-4-9-18(24)23-13-16-7-2-3-8-17(16)14-23/h2-3,7-8,15H,4-6,9-14H2,1H3,(H2,20,21) |
| InChIKey | CPGSFPDCTJCAKH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|