C13H26IN3O2 — CID 111025639
ethyl 4-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]butanoate;hydroiodide (PubChem CID 111025639) has the molecular formula C13H26IN3O2 and a molecular weight of 383.27 g/mol. Its IUPAC name is ethyl 4-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111025639 |
| Molecular Formula | C13H26IN3O2 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | ethyl 4-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]butanoate;hydroiodide |
| SMILES | CCOC(=O)CCC/N=C(\N)N1CCCC(C)C1.I |
| InChI | InChI=1S/C13H25N3O2.HI/c1-3-18-12(17)7-4-8-15-13(14)16-9-5-6-11(2)10-16;/h11H,3-10H2,1-2H3,(H2,14,15);1H |
| InChIKey | POHRFQCJCCAQQJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|