C16H24ClN3 — CID 111806836
N'-[3-(2-chlorophenyl)propyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111806836) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is N'-[3-(2-chlorophenyl)propyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[3-(2-chlorophenyl)propyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111806836 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N'-[3-(2-chlorophenyl)propyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CCCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H24ClN3/c1-13-6-5-11-20(12-13)16(18)19-10-4-8-14-7-2-3-9-15(14)17/h2-3,7,9,13H,4-6,8,10-12H2,1H3,(H2,18,19) |
| InChIKey | NIKALQZRFLYPJJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|