C15H22ClN3 — CID 111806874
N'-[3-(2-chlorophenyl)propyl]piperidine-1-carboximidamide (PubChem CID 111806874) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is N'-[3-(2-chlorophenyl)propyl]piperidine-1-carboximidamide.
| Compound Name | N'-[3-(2-chlorophenyl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111806874 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N'-[3-(2-chlorophenyl)propyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\CCCc1ccccc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C15H22ClN3/c16-14-9-3-2-7-13(14)8-6-10-18-15(17)19-11-4-1-5-12-19/h2-3,7,9H,1,4-6,8,10-12H2,(H2,17,18) |
| InChIKey | LHUXXUKQUZNYOO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|