C14H21ClIN3 — CID 111024810
N'-[2-(4-chlorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111024810) has the molecular formula C14H21ClIN3 and a molecular weight of 393.70 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-chlorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111024810 |
| Molecular Formula | C14H21ClIN3 |
| Molecular Weight | 393.70 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | N'-[2-(4-chlorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCc1ccc(Cl)cc1)N1CCCCC1 |
| InChI | InChI=1S/C14H20ClN3.HI/c15-13-6-4-12(5-7-13)8-9-17-14(16)18-10-2-1-3-11-18;/h4-7H,1-3,8-11H2,(H2,16,17);1H |
| InChIKey | MQNVNHRMSMSHBZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|