C15H24N4 — CID 75513059
N'-[2-(6-methyl-3-pyridinyl)ethyl]azepane-1-carboximidamide (PubChem CID 75513059) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is N'-[2-(6-methyl-3-pyridinyl)ethyl]azepane-1-carboximidamide.
| Compound Name | N'-[2-(6-methyl-3-pyridinyl)ethyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 75513059 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | N'-[2-(6-methyl-3-pyridinyl)ethyl]azepane-1-carboximidamide |
| SMILES | Cc1ccc(CC/N=C(\N)N2CCCCCC2)cn1 |
| InChI | InChI=1S/C15H24N4/c1-13-6-7-14(12-18-13)8-9-17-15(16)19-10-4-2-3-5-11-19/h6-7,12H,2-5,8-11H2,1H3,(H2,16,17) |
| InChIKey | QQDXSVOWWATLSY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|