C17H29IN4 — CID 111067891
N'-[3-[4-(dimethylamino)phenyl]propyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111067891) has the molecular formula C17H29IN4 and a molecular weight of 416.35 g/mol. Its IUPAC name is N'-[3-[4-(dimethylamino)phenyl]propyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-[4-(dimethylamino)phenyl]propyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111067891 |
| Molecular Formula | C17H29IN4 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N'-[3-[4-(dimethylamino)phenyl]propyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CN(C)c1ccc(CCC/N=C(\N)N2CCCCC2)cc1.I |
| InChI | InChI=1S/C17H28N4.HI/c1-20(2)16-10-8-15(9-11-16)7-6-12-19-17(18)21-13-4-3-5-14-21;/h8-11H,3-7,12-14H2,1-2H3,(H2,18,19);1H |
| InChIKey | MSSLGUMPVZWPOY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|