C22H36N4O — CID 111752022
N'-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111752022) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is N'-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111752022 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | N'-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CCCOC2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H36N4O/c1-19-7-5-13-26(17-19)22(23)24-12-6-16-27-21-10-14-25(15-11-21)18-20-8-3-2-4-9-20/h2-4,8-9,19,21H,5-7,10-18H2,1H3,(H2,23,24) |
| InChIKey | DNTIZUMWHBRFQH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|