C20H34N4O — CID 111751982
2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1,1-diethylguanidine (PubChem CID 111751982) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1,1-diethylguanidine.
| Compound Name | 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111751982 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCCOC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H34N4O/c1-3-24(4-2)20(21)22-13-8-16-25-19-11-14-23(15-12-19)17-18-9-6-5-7-10-18/h5-7,9-10,19H,3-4,8,11-17H2,1-2H3,(H2,21,22) |
| InChIKey | JHHHHLSKUZNUED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|