C24H38IN5OS — CID 109421109
2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109421109) has the molecular formula C24H38IN5OS and a molecular weight of 571.57 g/mol. Its IUPAC name is 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421109 |
| Molecular Formula | C24H38IN5OS |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC1CCN(Cc2ccccc2)CC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C24H37N5OS.HI/c1-4-25-24(28(3)18-22-19-31-20(2)27-22)26-13-8-16-30-23-11-14-29(15-12-23)17-21-9-6-5-7-10-21;/h5-7,9-10,19,23H,4,8,11-18H2,1-3H3,(H,25,26);1H |
| InChIKey | IUEJLWZOYMVIFV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|