C21H30IN5OS — CID 109425229
2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109425229) has the molecular formula C21H30IN5OS and a molecular weight of 527.48 g/mol. Its IUPAC name is 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109425229 |
| Molecular Formula | C21H30IN5OS |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)N1Cc2ccccc2C1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C21H29N5OS.HI/c1-4-22-21(25(3)14-19-15-28-16(2)24-19)23-11-7-10-20(27)26-12-17-8-5-6-9-18(17)13-26;/h5-6,8-9,15H,4,7,10-14H2,1-3H3,(H,22,23);1H |
| InChIKey | DRVPZEQZPKAQKY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|