C19H26N6S — CID 109422546
2-[3-(benzimidazol-1-yl)propyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109422546) has the molecular formula C19H26N6S and a molecular weight of 370.53 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[3-(benzimidazol-1-yl)propyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109422546 |
| Molecular Formula | C19H26N6S |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CCCn1cnc2ccccc21)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C19H26N6S/c1-4-20-19(24(3)12-16-13-26-15(2)23-16)21-10-7-11-25-14-22-17-8-5-6-9-18(17)25/h5-6,8-9,13-14H,4,7,10-12H2,1-3H3,(H,20,21) |
| InChIKey | XYHYXAHFLLBFHV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|