C19H27IN6S — CID 111933760
2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111933760) has the molecular formula C19H27IN6S and a molecular weight of 498.44 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111933760 |
| Molecular Formula | C19H27IN6S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1cnc2ccccc21)NCCc1csc(C)n1.I |
| InChI | InChI=1S/C19H26N6S.HI/c1-3-20-19(22-11-9-16-13-26-15(2)24-16)21-10-6-12-25-14-23-17-7-4-5-8-18(17)25;/h4-5,7-8,13-14H,3,6,9-12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | RJVKSADIOKTDNA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|